| Product Name | 4,6-Dimethyldibenzothiophene |
|---|---|
| Chinese alias | 4,6-DMDBT |
| CAS | 1207-12-1 |
| Formula | C14H12S |
| MW | 212.31 |
| Appearance | light yellow to light brown crystalline solid |
| MDL | MFCD00216264 |
| Melting point | 153-157 °C |
| Boiling point | 340 °C (approx) |
Product Center
MF:
C14H12S
MW:
212.31
Characters:light yellow to light brown crystalline solid
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB46095 | yunbang | 250mg | 95% | $8.33 | Visible after login | Inquiry | ||
| YB46095 | yunbang | 1g | 95% | $18.33 | Visible after login | Inquiry | ||
| YB46095 | yunbang | 5g | 95% | $90.00 | Visible after login | Inquiry | ||
| YB46095 | yunbang | 25g | 95% | $386.67 | Visible after login | Inquiry |
| Product Name | 4,6-Dimethyldibenzothiophene |
|---|---|
| Chinese alias | 4,6-DMDBT |
| CAS | 1207-12-1 |
| Formula | C14H12S |
| MW | 212.31 |
| Appearance | light yellow to light brown crystalline solid |
| MDL | MFCD00216264 |
| Melting point | 153-157 °C |
| Boiling point | 340 °C (approx) |
| Symbol | N/A |
|---|---|
| Safe Property | S24/25 |
| Chinese alias | 4,6-DMDBT |
|---|---|
| CAS | 1207-12-1 |
| Formula | C14H12S |
| MW | 212.31 |
| Appearance | light yellow to light brown crystalline solid |
| MDL | MFCD00216264 |
| Melting point | 153-157 °C |
| Boiling point | 340 °C (approx) |
| Safe Property | S24/25 |
| Water Solubility | 微溶 |
| Smiles | CC1C=CC=C2C3C(=C(C=CC=3)C)SC=12 |
| InchiKey | MYAQZIAVOLKEGW-UHFFFAOYSA-N |