Chinese alias | 1,2,3,5-ËÄÒÒõ£-¦Â-D-߻ૺËÌÇ¡¢ ËÄ-O-ÒÒõ£»ù-¦¢-D-߻ૺËÌÇ¡¢ËÄÒÒõ£ß»à«ºËÌÇ |
CAS | 13035-61-5 |
Formula | C13H18O9 |
MW | 318.28 |
Appearance | White to light yellow crystals |
MDL | MFCD00005358 |
Melting point | 81-83?¡ãC(lit.) |
Boiling point | 417.45¡ãC (lit.) |
Chemical Stability | Stable and avoid contact with strong oxidants |
Safe Property | S22-S24/25 |
Hazard Category Code | R36/37/38 |
Water Solubility | Solubility in Methanol almost transparency |
ÌØÐÔ | * |
ÓÃ; | ºËÜÕ(nucleoside) ºÏ³ÉµÄÆðʼÎïÙ|(zh¨¬)¡£ |
Storage | Inert atmosphere,Room Temperature |
Smiles | CC(OCC1OC(OC(C)=O)C(OC(C)=O)C1OC(C)=O)=O |
InchiKey | IHNHAHWGVLXCCI-UHFFFAOYSA-N |