| Chinese alias | ¾SÉúËØ B9¡¢Îì»ù†Î¹È°±Ëá¡¢µûõ£-L-¹È°±Ëá¡¢N-4-[(2-°±»ù-4-Ñõ´ú-1,4-¶þšä-6-à©à¤)¼×°±»ù±½¼×õ£»ù]-L-¹È°±Ëá¡¢ PteGlu¡¢¾SÉúËØ M |
|---|
| CAS | 59-30-3 |
|---|
| Formula | C19H19N7O6 |
|---|
| MW | 441.4 |
|---|
| Appearance | yellow to orange powder |
|---|
| MDL | MFCD00079305 |
|---|
| Melting point | 250 ¡ãC(lit.) |
|---|
| Boiling point | 552.35¡ãC(lit.) |
|---|
| Chemical Stability | Stable. Incompatible with heavy metal ions, strong oxidizing agents, strong reducing agents |
|---|
| Safe Property | S24/25 |
|---|
| Hazard Category Code | R33;R62;R68 |
|---|
| Water Solubility | 1.6 mg/L (25 oC) |
|---|
| ÌØÐÔ | * |
|---|
| ÓÃ; | ÓÃÓÚï•ÁÏ£¬¼š(x¨¬)°ûÅàðB(y¨£ng)²ÄÁÏ£¬át(y¨©)ËŽºÍʳƷ·½Ã棬µ«Ö÷ÒªÓÃÓÚï•ÁÏ¡£ |
|---|
| ß\(y¨´n)ݔҪÇó | ³£ÒŽ(gu¨©)ß\(y¨´n)Ý” |
|---|
| Storage | room temp |
|---|
| Smiles | C1C(C(NC(C(O)=O)CCC(O)=O)=O)=CC=C(NCC2N=C3C(NC(N)=NC3=NC=2)=O)C=1 |
|---|
| InchiKey | OVBPIULPVIDEAO-UHFFFAOYSA-N |
|---|
