Chinese alias | N6-±½¼×õ£»ù-5'-O-(4,4'-¶þ¼×Ñõ»ùÈý±½»ù)-2'-ÓÑõÏÙß° |
CAS | 64325-78-6 |
Formula | C38H35N5O6 |
MW | 657.71 |
Appearance | white to almost white powder |
MDL | MFCD00010058 |
Melting point | 94 ¡ãC(lit.) |
Boiling point | 681.42¡ãC(lit.) |
Chemical Stability | Stable and avoid contact with strong oxidants |
Safe Property | S22-S24/25 |
Hazard Category Code | R20/21/22;R36/37/38; |
Water Solubility | Slightly soluble |
ÌØÐÔ | * |
ÓÃ; | át(y¨©)ËŽÖÐégów¡£ |
Storage | Inert atmosphere,-20¡ãC |
Smiles | COC1C=CC(C(OCC2OC(N3C4C(=C(NC(C5C=CC=CC=5)=O)N=CN=4)N=C3)CC2O)(C2C=CC(OC)=CC=2)C2C=CC=CC=2)=CC=1 |
InchiKey | LPICNYATEWGYHI-UHFFFAOYSA-N |