Chinese alias | 4-[(¶þ±û»ù°±»ù)»Çõ£»ù]-;±½¼×Ëá¡¢Œ¦(du¨¬)[(¶þ±û°±»ù)»Çõ£»ù]±½¼×Ëá |
CAS | 57-66-9 |
Formula | C13H19NO4S |
MW | 285.359 |
Appearance | white solid |
MDL | MFCD00038402 |
Melting point | 198-199¡ãC(lit.) |
Boiling point | 438.0¡À47.0 ¡ãC(lit.) |
Chemical Stability | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
Safe Property | S24/25;S36/37; |
Hazard Category Code | R22;R40 |
Water Solubility | <0.1 g/100 mL |
ÌØÐÔ | * |
ÓÃ; | ÊÇÒ»·N½›(j¨©ng)µäµÄÓЙC(j¨©)êŽëx×Óß\(y¨´n)Ý”¸‚(j¨¬ng) Ž(zh¨¥ng)ÐÔÒÖÖÆ„©¡£ |
ß\(y¨´n)ݔҪÇó | ³£ÒŽ(gu¨©)ß\(y¨´n)Ý” |
Storage | Store at RT |
Smiles | CCCN(S(C1C=CC(C(O)=O)=CC=1)(=O)=O)CCC |
InchiKey | DBABZHXKTCFAPX-UHFFFAOYSA-N |